| Name |
1-Pyrrolidinecarboxylic acid, 2-(chlorocarbonyl)-, 2,2,2-trichloroethyl ester, (2S)-
|
| Molecular Formula |
C8H9Cl4NO3
|
| Molecular Weight |
309.0
|
| Smiles |
O=C(Cl)C1CCCN1C(=O)OCC(Cl)(Cl)Cl
|
O=C(Cl)C1CCCN1C(=O)OCC(Cl)(Cl)Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.