| Name |
3,3'-((3,3'-Dimethyl-[1,1'-biphenyl]-4,4'-diyl)bis(azanediyl))bis(2-hydroxypropane-1-sulfonic acid)
|
| Molecular Formula |
C20H28N2O8S2
|
| Molecular Weight |
488.6
|
| Smiles |
Cc1cc(-c2ccc(NCC(O)CS(=O)(=O)O)c(C)c2)ccc1NCC(O)CS(=O)(=O)O
|
Cc1cc(-c2ccc(NCC(O)CS(=O)(=O)O)c(C)c2)ccc1NCC(O)CS(=O)(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.