| Name |
ethyl 2-(3-benzyl-1,6,7-trimethyl-2,4-dioxo-3,4-dihydro-1H-imidazo[2,1-f]purin-8(2H)-yl)acetate
|
| Molecular Formula |
C21H23N5O4
|
| Molecular Weight |
409.4
|
| Smiles |
CCOC(=O)Cn1c(C)c(C)n2c3c(=O)n(Cc4ccccc4)c(=O)n(C)c3nc12
|
CCOC(=O)Cn1c(C)c(C)n2c3c(=O)n(Cc4ccccc4)c(=O)n(C)c3nc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.