| Name |
N-mesityl-2-((7-phenyl-6,7-dihydro-5H-imidazo[2,1-c][1,2,4]triazol-3-yl)thio)acetamide
|
| Molecular Formula |
C21H23N5OS
|
| Molecular Weight |
393.5
|
| Smiles |
Cc1cc(C)c(NC(=O)CSc2nnc3n2CCN3c2ccccc2)c(C)c1
|
Cc1cc(C)c(NC(=O)CSc2nnc3n2CCN3c2ccccc2)c(C)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.