| Name |
1-(2-Chlorophenyl)-4-(1,3-thiazol-2-yl)piperazine
|
| Molecular Formula |
C13H14ClN3S
|
| Molecular Weight |
279.79
|
| Smiles |
Clc1ccccc1N1CCN(c2nccs2)CC1
|
Clc1ccccc1N1CCN(c2nccs2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.