| Name |
N-(2-{2-acetyl-3'-methyl-1'-phenyl-3,4-dihydro-1'H,2H-[3,4'-bipyrazole]-5-yl}phenyl)methanesulfonamide
|
| Molecular Formula |
C22H23N5O3S
|
| Molecular Weight |
437.5
|
| Smiles |
CC(=O)N1N=C(c2ccccc2NS(C)(=O)=O)CC1c1cn(-c2ccccc2)nc1C
|
CC(=O)N1N=C(c2ccccc2NS(C)(=O)=O)CC1c1cn(-c2ccccc2)nc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.