| Name |
N-({1-[3-(3,5-dimethylphenoxy)propyl]benzimidazol-2-yl}methyl)-2-furyl-N-methy lcarboxamide
|
| Molecular Formula |
C25H27N3O3
|
| Molecular Weight |
417.5
|
| Smiles |
Cc1cc(C)cc(OCCCn2c(CN(C)C(=O)c3ccco3)nc3ccccc32)c1
|
Cc1cc(C)cc(OCCCn2c(CN(C)C(=O)c3ccco3)nc3ccccc32)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.