| Name |
Ruthenium(II) 2,2,2-trifluoroacetate
|
| Molecular Formula |
C4F6O4Ru
|
| Molecular Weight |
327.1
|
| Smiles |
O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F.[Ru+2]
|
O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F.[Ru+2]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.