| Name |
10,13-Dimethyl-17-[1-[5-methyl-6-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]ethyl]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-6-one
|
| Molecular Formula |
C39H62O13
|
| Molecular Weight |
738.9
|
| Smiles |
CC1CCC(C(C)C2CCC3C4=CC(=O)C5CC(OC6OC(CO)C(O)C(O)C6O)CCC5(C)C4CCC32C)OC1OC1OC(C)C(O)C(O)C1O
|
CC1CCC(C(C)C2CCC3C4=CC(=O)C5CC(OC6OC(CO)C(O)C(O)C6O)CCC5(C)C4CCC32C)OC1OC1OC(C)C(O)C(O)C1O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.