| Name |
2-propyl-6,7-dihydro[1,2,4]triazolo[5,1-b]quinazolin-8(5H)-one
|
| Molecular Formula |
C12H14N4O
|
| Molecular Weight |
230.27
|
| Smiles |
CCCc1nc2nc3c(cn2n1)C(=O)CCC3
|
CCCc1nc2nc3c(cn2n1)C(=O)CCC3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.