| Name |
(Z)-2-((1S,4S,7R)-7-(bromomethyl)-4,7-dimethyl-3-oxobicyclo[2.2.1]heptan-2-ylidene)hydrazinecarboximidamide hydrochloride
|
| Molecular Formula |
C11H18BrClN4O
|
| Molecular Weight |
337.64
|
| Smiles |
CC12CCC(C(=NN=C(N)N)C1=O)C2(C)CBr.Cl
|
CC12CCC(C(=NN=C(N)N)C1=O)C2(C)CBr.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.