| Name |
L-Serine, glycyl-L-threonyl-L-leucyl-L-valyl-L-threonyl-L-valyl-L-seryl-
|
| Molecular Formula |
C32H58N8O13
|
| Molecular Weight |
762.8
|
| Smiles |
CC(C)CC(NC(=O)C(NC(=O)CN)C(C)O)C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(CO)C(=O)NC(CO)C(=O)O)C(C)C)C(C)O)C(C)C
|
CC(C)CC(NC(=O)C(NC(=O)CN)C(C)O)C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(CO)C(=O)NC(CO)C(=O)O)C(C)C)C(C)O)C(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.