| Name |
6-[2-({3-[2-(4-fluorophenyl)ethyl]-4-oxo-3,4-dihydroquinazolin-2-yl}sulfanyl)acetyl]-3,4-dihydro-2H-1,4-benzoxazin-3-one
|
| Molecular Formula |
C26H20FN3O4S
|
| Molecular Weight |
489.5
|
| Smiles |
O=C1COc2ccc(C(=O)CSc3nc4ccccc4c(=O)n3CCc3ccc(F)cc3)cc2N1
|
O=C1COc2ccc(C(=O)CSc3nc4ccccc4c(=O)n3CCc3ccc(F)cc3)cc2N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.