| Name |
2-[7-(4-bromophenyl)-3,8-dioxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl]-N-(2,5-difluorophenyl)acetamide
|
| Molecular Formula |
C19H12BrF2N5O3
|
| Molecular Weight |
476.2
|
| Smiles |
O=C(Cn1nc2c(=O)n(-c3ccc(Br)cc3)ccn2c1=O)Nc1cc(F)ccc1F
|
O=C(Cn1nc2c(=O)n(-c3ccc(Br)cc3)ccn2c1=O)Nc1cc(F)ccc1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.