| Name |
5-[({6-methylimidazo[1,2-a]pyridin-2-yl}methyl)sulfanyl]-N-[(oxolan-2-yl)methyl]-1,3,4-thiadiazol-2-amine
|
| Molecular Formula |
C16H19N5OS2
|
| Molecular Weight |
361.5
|
| Smiles |
Cc1ccc2nc(CSc3nnc(NCC4CCCO4)s3)cn2c1
|
Cc1ccc2nc(CSc3nnc(NCC4CCCO4)s3)cn2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.