| Name |
5-Methyl-2-(2,3,4,5,6-pentafluorophenyl)-3,6-dihydrothiazine 1-oxide
|
| Molecular Formula |
C11H8F5NOS
|
| Molecular Weight |
297.25
|
| Smiles |
CC1=CCN(c2c(F)c(F)c(F)c(F)c2F)S(=O)C1
|
CC1=CCN(c2c(F)c(F)c(F)c(F)c2F)S(=O)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.