| Name |
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]chroman-4-one
|
| Molecular Formula |
C21H22O12
|
| Molecular Weight |
466.4
|
| Smiles |
O=C1c2c(cc(O)c(C3OC(CO)C(O)C(O)C3O)c2O)OC(c2ccc(O)c(O)c2)C1O
|
O=C1c2c(cc(O)c(C3OC(CO)C(O)C(O)C3O)c2O)OC(c2ccc(O)c(O)c2)C1O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.