| Name |
AR-C-89855 hydrochloride
|
| Molecular Formula |
C23H32ClN3O5S2
|
| Molecular Weight |
530.1
|
| Smiles |
Cc1ccc(CCOCCNS(=O)(=O)CCCNCCc2ccc(O)c3[nH]c(=O)sc23)cc1.Cl
|
Cc1ccc(CCOCCNS(=O)(=O)CCCNCCc2ccc(O)c3[nH]c(=O)sc23)cc1.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.