| Name |
(6R,8R)-7,7-Dimethyl-5,6,7,8-tetrahydro-6,8-methanoquinolin-2-yl trifluoromethanesulfonate
|
| Molecular Formula |
C13H14F3NO3S
|
| Molecular Weight |
321.32
|
| Smiles |
CC1(C)C2Cc3ccc(OS(=O)(=O)C(F)(F)F)nc3C1C2
|
CC1(C)C2Cc3ccc(OS(=O)(=O)C(F)(F)F)nc3C1C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.