| Name |
4-Phenyl-1H,3H-naphtho[1,8-cd]pyran-1,3-dione
|
| Molecular Formula |
C18H10O3
|
| Molecular Weight |
274.3
|
| Smiles |
O=C1OC(=O)c2c(-c3ccccc3)ccc3cccc1c23
|
O=C1OC(=O)c2c(-c3ccccc3)ccc3cccc1c23
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.