| Name |
4-(5-Chloro-6,7-dimethoxy-4-oxo-4H-quinazolin-3-yl)-butyric acid ethyl ester
|
| Molecular Formula |
C16H19ClN2O5
|
| Molecular Weight |
354.78
|
| Smiles |
CCOC(=O)CCCn1cnc2cc(OC)c(OC)c(Cl)c2c1=O
|
CCOC(=O)CCCn1cnc2cc(OC)c(OC)c(Cl)c2c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.