| Name |
2,2-Diallyl-5-methoxy-2,3-dihydroinden-1-one
|
| Molecular Formula |
C16H18O2
|
| Molecular Weight |
242.31
|
| Smiles |
C=CCC1(CC=C)Cc2cc(OC)ccc2C1=O
|
C=CCC1(CC=C)Cc2cc(OC)ccc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.