| Name |
(Z)-N-(1-(7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5(6H)-ylidene)-4-methyl-2-oxopentan-3-yl)benzamide
|
| Molecular Formula |
C23H24N2O4
|
| Molecular Weight |
392.4
|
| Smiles |
CC(C)C(NC(=O)c1ccccc1)C(=O)C=C1NCCc2cc3c(cc21)OCO3
|
CC(C)C(NC(=O)c1ccccc1)C(=O)C=C1NCCc2cc3c(cc21)OCO3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.