| Name |
2-acetyl-1'-methyl-2,3,4,9-tetrahydrospiro[beta-carboline-1,3'-indol]-2'(1'H)-one
|
| Molecular Formula |
C21H19N3O2
|
| Molecular Weight |
345.4
|
| Smiles |
CC(=O)N1CCc2c([nH]c3ccccc23)C12C(=O)N(C)c1ccccc12
|
CC(=O)N1CCc2c([nH]c3ccccc23)C12C(=O)N(C)c1ccccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.