| Name |
2,2-Dimethyl-5,7-bis(phenylmethoxy)-1,3-benzodioxin-4-one
|
| Molecular Formula |
C24H22O5
|
| Molecular Weight |
390.4
|
| Smiles |
CC1(C)OC(=O)c2c(OCc3ccccc3)cc(OCc3ccccc3)cc2O1
|
CC1(C)OC(=O)c2c(OCc3ccccc3)cc(OCc3ccccc3)cc2O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.