| Name |
5-(furan-2-yl)-2-{[4-(2-phenylethenesulfonyl)piperazin-1-yl]methyl}-3H,4H-thieno[2,3-d]pyrimidin-4-one
|
| Molecular Formula |
C23H22N4O4S2
|
| Molecular Weight |
482.6
|
| Smiles |
O=c1[nH]c(CN2CCN(S(=O)(=O)C=Cc3ccccc3)CC2)nc2scc(-c3ccco3)c12
|
O=c1[nH]c(CN2CCN(S(=O)(=O)C=Cc3ccccc3)CC2)nc2scc(-c3ccco3)c12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.