| Name |
4,4,5,5-tetramethyl-2-(1,2,2-trimethylpropyl)-1,3,2-dioxaborolane
|
| Molecular Formula |
C12H25BO2
|
| Molecular Weight |
212.14
|
| Smiles |
CC(B1OC(C)(C)C(C)(C)O1)C(C)(C)C
|
CC(B1OC(C)(C)C(C)(C)O1)C(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.