| Name |
ethyl 4-{2-[3-(3-chloro-4-methylphenyl)-7-oxo-3H,6H,7H-[1,2,3]triazolo[4,5-d]pyrimidin-6-yl]acetyl}piperazine-1-carboxylate
|
| Molecular Formula |
C20H22ClN7O4
|
| Molecular Weight |
459.9
|
| Smiles |
CCOC(=O)N1CCN(C(=O)Cn2cnc3c(nnn3-c3ccc(C)c(Cl)c3)c2=O)CC1
|
CCOC(=O)N1CCN(C(=O)Cn2cnc3c(nnn3-c3ccc(C)c(Cl)c3)c2=O)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.