| Name |
1-(3,4-dimethoxyphenyl)-3-{[1-(3,4-dimethylphenyl)-1H-1,2,3,4-tetrazol-5-yl]methyl}urea
|
| Molecular Formula |
C19H22N6O3
|
| Molecular Weight |
382.4
|
| Smiles |
COc1ccc(NC(=O)NCc2nnnn2-c2ccc(C)c(C)c2)cc1OC
|
COc1ccc(NC(=O)NCc2nnnn2-c2ccc(C)c(C)c2)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.