| Name |
2,4-dichloro-N-(4-{2-methyl-4-oxo-3H,4H-pyrido[2,3-d]pyrimidin-3-yl}phenyl)benzamide
|
| Molecular Formula |
C21H14Cl2N4O2
|
| Molecular Weight |
425.3
|
| Smiles |
Cc1nc2ncccc2c(=O)n1-c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1
|
Cc1nc2ncccc2c(=O)n1-c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.