| Name |
N-(4-chlorophenyl)-2-{2-oxo-6-phenyl-10-thia-1,5,6,8-tetraazatricyclo[7.3.0.0^{3,7}]dodeca-3(7),4,8-trien-12-yl}acetamide
|
| Molecular Formula |
C21H16ClN5O2S
|
| Molecular Weight |
437.9
|
| Smiles |
O=C(CC1CSc2nc3c(cnn3-c3ccccc3)c(=O)n21)Nc1ccc(Cl)cc1
|
O=C(CC1CSc2nc3c(cnn3-c3ccccc3)c(=O)n21)Nc1ccc(Cl)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.