| Name |
ethyl 2-{2-[1-(2,4-dimethylphenyl)-4-oxo-1H,4H,5H-pyrazolo[3,4-d]pyrimidin-5-yl]acetamido}benzoate
|
| Molecular Formula |
C24H23N5O4
|
| Molecular Weight |
445.5
|
| Smiles |
CCOC(=O)c1ccccc1NC(=O)Cn1cnc2c(cnn2-c2ccc(C)cc2C)c1=O
|
CCOC(=O)c1ccccc1NC(=O)Cn1cnc2c(cnn2-c2ccc(C)cc2C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.