| Name |
methyl 1-allyl-2'-amino-6'-(hydroxymethyl)-2,8'-dioxo-8'H-spiro[indoline-3,4'-pyrano[3,2-b]pyran]-3'-carboxylate
|
| Molecular Formula |
C21H18N2O7
|
| Molecular Weight |
410.4
|
| Smiles |
C=CCN1C(=O)C2(C(C(=O)OC)=C(N)Oc3c2oc(CO)cc3=O)c2ccccc21
|
C=CCN1C(=O)C2(C(C(=O)OC)=C(N)Oc3c2oc(CO)cc3=O)c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.