| Name |
methyl 2'-amino-1-(carbamoylmethyl)-6'-(hydroxymethyl)-2,8'-dioxo-1,2-dihydro-8'H-spiro[indole-3,4'-pyrano[3,2-b]pyran]-3'-carboxylate
|
| Molecular Formula |
C20H17N3O8
|
| Molecular Weight |
427.4
|
| Smiles |
COC(=O)C1=C(N)Oc2c(oc(CO)cc2=O)C12C(=O)N(CC(N)=O)c1ccccc12
|
COC(=O)C1=C(N)Oc2c(oc(CO)cc2=O)C12C(=O)N(CC(N)=O)c1ccccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.