| Name |
N-(4-nitrophenyl)-2-{[5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetamide
|
| Molecular Formula |
C15H11N5O4S
|
| Molecular Weight |
357.3
|
| Smiles |
O=C(CSc1nnc(-c2ccncc2)o1)Nc1ccc([N+](=O)[O-])cc1
|
O=C(CSc1nnc(-c2ccncc2)o1)Nc1ccc([N+](=O)[O-])cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.