| Name |
N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-{[3-(2,4,6-trimethylbenzenesulfonyl)-1,3-oxazolidin-2-yl]methyl}ethanediamide
|
| Molecular Formula |
C25H33N3O7S
|
| Molecular Weight |
519.6
|
| Smiles |
COc1ccc(CCNC(=O)C(=O)NCC2OCCN2S(=O)(=O)c2c(C)cc(C)cc2C)cc1OC
|
COc1ccc(CCNC(=O)C(=O)NCC2OCCN2S(=O)(=O)c2c(C)cc(C)cc2C)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.