| Name |
2-amino-N-[6-(imidazo[1,2-d][1,2,4]thiadiazol-3-ylamino)hexyl]benzenesulfonamide
|
| Molecular Formula |
C16H22N6O2S2
|
| Molecular Weight |
394.5
|
| Smiles |
Nc1ccccc1S(=O)(=O)NCCCCCCNc1nsc2nccn12
|
Nc1ccccc1S(=O)(=O)NCCCCCCNc1nsc2nccn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.