| Name |
3-(3-methoxypropyl)-2,11-dimethyl-8-nitro-2,3,5,6-tetrahydro-4H-2,6-methano-1,3,5-benzoxadiazocine-4-thione
|
| Molecular Formula |
C16H21N3O4S
|
| Molecular Weight |
351.4
|
| Smiles |
COCCCN1C(=S)NC2c3cc([N+](=O)[O-])ccc3OC1(C)C2C
|
COCCCN1C(=S)NC2c3cc([N+](=O)[O-])ccc3OC1(C)C2C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.