| Name |
N,N'-((1S,2S)-1,2-Diphenylethane-1,2-diyl)bis(2,4,6-trimethylbenzenesulfonamide)
|
| Molecular Formula |
C32H36N2O4S2
|
| Molecular Weight |
576.8
|
| Smiles |
Cc1cc(C)c(S(=O)(=O)NC(c2ccccc2)C(NS(=O)(=O)c2c(C)cc(C)cc2C)c2ccccc2)c(C)c1
|
Cc1cc(C)c(S(=O)(=O)NC(c2ccccc2)C(NS(=O)(=O)c2c(C)cc(C)cc2C)c2ccccc2)c(C)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.