| Name |
N-benzyl-2-(3'-(3,4-dimethylphenyl)-2,4'-dioxospiro[indoline-3,2'-thiazolidin]-1-yl)acetamide
|
| Molecular Formula |
C27H25N3O3S
|
| Molecular Weight |
471.6
|
| Smiles |
Cc1ccc(N2C(=O)CSC23C(=O)N(CC(=O)NCc2ccccc2)c2ccccc23)cc1C
|
Cc1ccc(N2C(=O)CSC23C(=O)N(CC(=O)NCc2ccccc2)c2ccccc23)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.