| Name |
1-(tert-butyl)-3-((1-(3,4-dimethylphenyl)-1H-tetrazol-5-yl)methyl)urea
|
| Molecular Formula |
C15H22N6O
|
| Molecular Weight |
302.37
|
| Smiles |
Cc1ccc(-n2nnnc2CNC(=O)NC(C)(C)C)cc1C
|
Cc1ccc(-n2nnnc2CNC(=O)NC(C)(C)C)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.