| Name |
N-{(1Z)-1-[5-(2,4-dichlorophenyl)furan-2-yl]-3-[(2-methoxyethyl)amino]-3-oxoprop-1-en-2-yl}-4-methylbenzamide
|
| Molecular Formula |
C24H22Cl2N2O4
|
| Molecular Weight |
473.3
|
| Smiles |
COCCNC(=O)C(=Cc1ccc(-c2ccc(Cl)cc2Cl)o1)NC(=O)c1ccc(C)cc1
|
COCCNC(=O)C(=Cc1ccc(-c2ccc(Cl)cc2Cl)o1)NC(=O)c1ccc(C)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.