| Name |
2-(2,4-dimethoxybenzamido)-6-(propan-2-yl)-4H,5H,6H,7H-thieno[2,3-c]pyridine-3-carboxamide hydrochloride
|
| Molecular Formula |
C20H26ClN3O4S
|
| Molecular Weight |
440.0
|
| Smiles |
COc1ccc(C(=O)Nc2sc3c(c2C(N)=O)CCN(C(C)C)C3)c(OC)c1.Cl
|
COc1ccc(C(=O)Nc2sc3c(c2C(N)=O)CCN(C(C)C)C3)c(OC)c1.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.