| Name |
2-{[5-(4,5-dibromothiophen-2-yl)-4-ethyl-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide
|
| Molecular Formula |
C10H10Br2N4OS2
|
| Molecular Weight |
426.2
|
| Smiles |
CCn1c(SCC(N)=O)nnc1-c1cc(Br)c(Br)s1
|
CCn1c(SCC(N)=O)nnc1-c1cc(Br)c(Br)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.