| Name |
N-(2-furylmethyl)-4-{[1-(2-methylbenzyl)-2,4-dioxo-1,4-dihydrothieno[3,2-d]pyrimidin-3(2H)-yl]methyl}cyclohexanecarboxamide
|
| Molecular Formula |
C27H29N3O4S
|
| Molecular Weight |
491.6
|
| Smiles |
Cc1ccccc1Cn1c(=O)n(CC2CCC(C(=O)NCc3ccco3)CC2)c(=O)c2sccc21
|
Cc1ccccc1Cn1c(=O)n(CC2CCC(C(=O)NCc3ccco3)CC2)c(=O)c2sccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.