| Name |
4-((1-(3-chlorobenzyl)-2,4-dioxo-1,2-dihydrothieno[3,2-d]pyrimidin-3(4H)-yl)methyl)-N-isopropylcyclohexanecarboxamide
|
| Molecular Formula |
C24H28ClN3O3S
|
| Molecular Weight |
474.0
|
| Smiles |
CC(C)NC(=O)C1CCC(Cn2c(=O)c3sccc3n(Cc3cccc(Cl)c3)c2=O)CC1
|
CC(C)NC(=O)C1CCC(Cn2c(=O)c3sccc3n(Cc3cccc(Cl)c3)c2=O)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.