| Name |
2-Propenoic acid,2-amino-3-imidazo[1,2-a]pyridin-2-yl-,ethyl ester
|
| Molecular Formula |
C12H13N3O2
|
| Molecular Weight |
231.25
|
| Smiles |
CCOC(=O)C(N)=Cc1cn2ccccc2n1
|
CCOC(=O)C(N)=Cc1cn2ccccc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.