| Name |
N-([1,3]dioxolo[4',5':4,5]benzo[1,2-d]thiazol-6-yl)-2-chloro-N-(2-(diethylamino)ethyl)benzamide hydrochloride
|
| Molecular Formula |
C21H23Cl2N3O3S
|
| Molecular Weight |
468.4
|
| Smiles |
CCN(CC)CCN(C(=O)c1ccccc1Cl)c1nc2cc3c(cc2s1)OCO3.Cl
|
CCN(CC)CCN(C(=O)c1ccccc1Cl)c1nc2cc3c(cc2s1)OCO3.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.