| Name |
6-Chloro-N4-(2,3-dimethylphenyl)-N2,N2,N4-trimethyl-2,4-pyrimidinediamine
|
| Molecular Formula |
C15H19ClN4
|
| Molecular Weight |
290.79
|
| Smiles |
Cc1cccc(N(C)c2cc(Cl)nc(N(C)C)n2)c1C
|
Cc1cccc(N(C)c2cc(Cl)nc(N(C)C)n2)c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.