| Name |
(2E)-5-Methyl-5-[[(2,2,2-trichloroethoxy)carbonyl]amino]-2-hexenoic acid
|
| Molecular Formula |
C10H14Cl3NO4
|
| Molecular Weight |
318.6
|
| Smiles |
CC(C)(CC=CC(=O)O)NC(=O)OCC(Cl)(Cl)Cl
|
CC(C)(CC=CC(=O)O)NC(=O)OCC(Cl)(Cl)Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.